About 2,4-bis(hydroxymethyl)-3,5-dimethylphenol
2,4-bis(hydroxymethyl)-3,5-dimethylphenol (PubChem CID 71367739) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,4-bis(hydroxymethyl)-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2,4-bis(hydroxymethyl)-3,5-dimethylphenol |
| PubChem CID | 71367739 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,4-bis(hydroxymethyl)-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CO)c(C)c1CO |
| InChI | InChI=1S/C10H14O3/c1-6-3-10(13)9(5-12)7(2)8(6)4-11/h3,11-13H,4-5H2,1-2H3 |
| InChIKey | XUUSEXAKAGXSJX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(hydroxymethyl)-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(hydroxymethyl)-3,5-dimethylphenol?
The IUPAC name of 2,4-bis(hydroxymethyl)-3,5-dimethylphenol (CID 71367739) is 2,4-bis(hydroxymethyl)-3,5-dimethylphenol.
What is the SMILES notation for 2,4-bis(hydroxymethyl)-3,5-dimethylphenol?
The canonical SMILES for 2,4-bis(hydroxymethyl)-3,5-dimethylphenol is Cc1cc(O)c(CO)c(C)c1CO.
What is the InChIKey of 2,4-bis(hydroxymethyl)-3,5-dimethylphenol?
The InChIKey is XUUSEXAKAGXSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-6-3-10(13)9(5-12)7(2)8(6)4-11/h3,11-13H,4-5H2,1-2H3.
What are the key properties of 2,4-bis(hydroxymethyl)-3,5-dimethylphenol?
2,4-bis(hydroxymethyl)-3,5-dimethylphenol has a molecular weight of 182.22 g/mol, XLogP of 0.99, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(hydroxymethyl)-3,5-dimethylphenol is sourced from PubChem (CID 71367739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).