About 3,7-dimethyl-2,7-naphthyridin-1-one
3,7-dimethyl-2,7-naphthyridin-1-one (PubChem CID 71367861) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,7-dimethyl-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 3,7-dimethyl-2,7-naphthyridin-1-one |
| PubChem CID | 71367861 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3,7-dimethyl-2,7-naphthyridin-1-one |
| SMILES | Cc1cc2ccn(C)cc-2c(=O)n1 |
| InChI | InChI=1S/C10H10N2O/c1-7-5-8-3-4-12(2)6-9(8)10(13)11-7/h3-6H,1-2H3 |
| InChIKey | AFAPJDGZMJIGOW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dimethyl-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-2,7-naphthyridin-1-one?
The IUPAC name of 3,7-dimethyl-2,7-naphthyridin-1-one (CID 71367861) is 3,7-dimethyl-2,7-naphthyridin-1-one.
What is the SMILES notation for 3,7-dimethyl-2,7-naphthyridin-1-one?
The canonical SMILES for 3,7-dimethyl-2,7-naphthyridin-1-one is Cc1cc2ccn(C)cc-2c(=O)n1.
What is the InChIKey of 3,7-dimethyl-2,7-naphthyridin-1-one?
The InChIKey is AFAPJDGZMJIGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-7-5-8-3-4-12(2)6-9(8)10(13)11-7/h3-6H,1-2H3.
What are the key properties of 3,7-dimethyl-2,7-naphthyridin-1-one?
3,7-dimethyl-2,7-naphthyridin-1-one has a molecular weight of 174.20 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-2,7-naphthyridin-1-one is sourced from PubChem (CID 71367861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).