About 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one
6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one (PubChem CID 71368277) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 71368277 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one |
| SMILES | CC1=CC2=NCCN2C(=O)N1C |
| InChI | InChI=1S/C8H11N3O/c1-6-5-7-9-3-4-11(7)8(12)10(6)2/h5H,3-4H2,1-2H3 |
| InChIKey | PGZCEGAKGCYTNG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one (CID 71368277) is 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one is CC1=CC2=NCCN2C(=O)N1C.
What is the InChIKey of 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one?
The InChIKey is PGZCEGAKGCYTNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-6-5-7-9-3-4-11(7)8(12)10(6)2/h5H,3-4H2,1-2H3.
What are the key properties of 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one?
6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one has a molecular weight of 165.20 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2,3-dihydroimidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 71368277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).