About deca-1,7-dien-4-ol
deca-1,7-dien-4-ol (PubChem CID 71368802) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is deca-1,7-dien-4-ol.
Molecular Properties
| Compound Name | deca-1,7-dien-4-ol |
| PubChem CID | 71368802 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | deca-1,7-dien-4-ol |
| SMILES | C=CCC(O)CCC=CCC |
| InChI | InChI=1S/C10H18O/c1-3-5-6-7-9-10(11)8-4-2/h4-6,10-11H,2-3,7-9H2,1H3 |
| InChIKey | RUANIJKRDSEAQM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze deca-1,7-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deca-1,7-dien-4-ol?
The IUPAC name of deca-1,7-dien-4-ol (CID 71368802) is deca-1,7-dien-4-ol.
What is the SMILES notation for deca-1,7-dien-4-ol?
The canonical SMILES for deca-1,7-dien-4-ol is C=CCC(O)CCC=CCC.
What is the InChIKey of deca-1,7-dien-4-ol?
The InChIKey is RUANIJKRDSEAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-3-5-6-7-9-10(11)8-4-2/h4-6,10-11H,2-3,7-9H2,1H3.
What are the key properties of deca-1,7-dien-4-ol?
deca-1,7-dien-4-ol has a molecular weight of 154.25 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deca-1,7-dien-4-ol is sourced from PubChem (CID 71368802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).