C9H10O5 — CID 71368997
2,5-bis(hydroxymethyl)-3-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 71368997) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2,5-bis(hydroxymethyl)-3-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(hydroxymethyl)-3-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71368997 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2,5-bis(hydroxymethyl)-3-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(CO)C(=O)C=C(CO)C1=O |
| InChI | InChI=1S/C9H10O5/c1-14-9-6(4-11)7(12)2-5(3-10)8(9)13/h2,10-11H,3-4H2,1H3 |
| InChIKey | XQRAJSRDKHRDGZ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|