C7H5F9O2S — CID 71369456
1,1,1,2,2,3,3,4,4-nonafluoro-4-prop-1-enylsulfonylbutane (PubChem CID 71369456) has the molecular formula C7H5F9O2S and a molecular weight of 324.16 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-prop-1-enylsulfonylbutane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-prop-1-enylsulfonylbutane |
|---|---|
| PubChem CID | 71369456 |
| Molecular Formula | C7H5F9O2S |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-prop-1-enylsulfonylbutane |
| SMILES | CC=CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O2S/c1-2-3-19(17,18)7(15,16)5(10,11)4(8,9)6(12,13)14/h2-3H,1H3 |
| InChIKey | RGKAEHDYNMLWRB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|