About N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine
N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine (PubChem CID 71370058) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine |
| PubChem CID | 71370058 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1cc(C)sc1C |
| InChI | InChI=1S/C8H11NOS/c1-5-4-8(6(2)9-10)7(3)11-5/h4,10H,1-3H3 |
| InChIKey | SBTUQKDDLZOUJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine?
The IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine (CID 71370058) is N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine.
What is the SMILES notation for N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine?
The canonical SMILES for N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine is CC(=NO)c1cc(C)sc1C.
What is the InChIKey of N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine?
The InChIKey is SBTUQKDDLZOUJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c1-5-4-8(6(2)9-10)7(3)11-5/h4,10H,1-3H3.
What are the key properties of N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine?
N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine has a molecular weight of 169.25 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethylthiophen-3-yl)ethylidene]hydroxylamine is sourced from PubChem (CID 71370058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).