C32H72O20Si4 — CID 71370392
2,2,4,4,6,6,8,8-octakis(tert-butylperoxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 71370392) has the molecular formula C32H72O20Si4 and a molecular weight of 889.25 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octakis(tert-butylperoxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4,6,6,8,8-octakis(tert-butylperoxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 71370392 |
| Molecular Formula | C32H72O20Si4 |
| Molecular Weight | 889.25 g/mol |
| Exact Mass | 888.37 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octakis(tert-butylperoxy)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C)(C)OO[Si]1(OOC(C)(C)C)O[Si](OOC(C)(C)C)(OOC(C)(C)C)O[Si](OOC(C)(C)C)(OOC(C)(C)C)O[Si](OOC(C)(C)C)(OOC(C)(C)C)O1 |
| InChI | InChI=1S/C32H72O20Si4/c1-25(2,3)33-41-53(42-34-26(4,5)6)49-54(43-35-27(7,8)9,44-36-28(10,11)12)51-56(47-39-31(19,20)21,48-40-32(22,23)24)52-55(50-53,45-37-29(13,14)15)46-38-30(16,17)18/h1-24H3 |
| InChIKey | DMPZDDZKJAGVRW-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.25 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|