About 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene
7,8-diazabicyclo[4.2.2]deca-2,4,7-triene (PubChem CID 71370922) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene.
Molecular Properties
| Compound Name | 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene |
| PubChem CID | 71370922 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene |
| SMILES | C1=CC2CCC(C=C1)N=N2 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-6-5-7(3-1)9-10-8/h1-4,7-8H,5-6H2 |
| InChIKey | GAWFNIGFJDTWBM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene?
The IUPAC name of 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene (CID 71370922) is 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene.
What is the SMILES notation for 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene?
The canonical SMILES for 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene is C1=CC2CCC(C=C1)N=N2.
What is the InChIKey of 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene?
The InChIKey is GAWFNIGFJDTWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-4-8-6-5-7(3-1)9-10-8/h1-4,7-8H,5-6H2.
What are the key properties of 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene?
7,8-diazabicyclo[4.2.2]deca-2,4,7-triene has a molecular weight of 134.18 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diazabicyclo[4.2.2]deca-2,4,7-triene is sourced from PubChem (CID 71370922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).