C10H15BrCl2 — CID 71371256
5-bromo-3,8-dichloro-2,6-dimethylocta-1,6-diene (PubChem CID 71371256) has the molecular formula C10H15BrCl2 and a molecular weight of 286.04 g/mol. Its IUPAC name is 5-bromo-3,8-dichloro-2,6-dimethylocta-1,6-diene.
| Compound Name | 5-bromo-3,8-dichloro-2,6-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 71371256 |
| Molecular Formula | C10H15BrCl2 |
| Molecular Weight | 286.04 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 5-bromo-3,8-dichloro-2,6-dimethylocta-1,6-diene |
| SMILES | C=C(C)C(Cl)CC(Br)C(C)=CCCl |
| InChI | InChI=1S/C10H15BrCl2/c1-7(2)10(13)6-9(11)8(3)4-5-12/h4,9-10H,1,5-6H2,2-3H3 |
| InChIKey | AADSQRFHTJGABO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|