C12H10N2 — CID 71371462
5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile (PubChem CID 71371462) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile.
| Compound Name | 5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 71371462 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c2c(c1)CCCC2 |
| InChI | InChI=1S/C12H10N2/c13-7-9-5-10-3-1-2-4-12(10)11(6-9)8-14/h5-6H,1-4H2 |
| InChIKey | VEXUWIFZLYDMQI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |