About 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol
1,6-dimethyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 71371609) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 71371609 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | Cc1cc2c(cc1O)CCC2C |
| InChI | InChI=1S/C11H14O/c1-7-3-4-9-6-11(12)8(2)5-10(7)9/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | VPPXEGFGEKWKQW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol (CID 71371609) is 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol is Cc1cc2c(cc1O)CCC2C.
What is the InChIKey of 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is VPPXEGFGEKWKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-7-3-4-9-6-11(12)8(2)5-10(7)9/h5-7,12H,3-4H2,1-2H3.
What are the key properties of 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol?
1,6-dimethyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 162.23 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 71371609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).