C17H12N2O3 — CID 71371747
3-(furan-2-yl)-6-methyl-1-phenylpyrano[4,3-c]pyrazol-4-one (PubChem CID 71371747) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-(furan-2-yl)-6-methyl-1-phenylpyrano[4,3-c]pyrazol-4-one.
| Compound Name | 3-(furan-2-yl)-6-methyl-1-phenylpyrano[4,3-c]pyrazol-4-one |
|---|---|
| PubChem CID | 71371747 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-(furan-2-yl)-6-methyl-1-phenylpyrano[4,3-c]pyrazol-4-one |
| SMILES | Cc1cc2c(c(-c3ccco3)nn2-c2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C17H12N2O3/c1-11-10-13-15(17(20)22-11)16(14-8-5-9-21-14)18-19(13)12-6-3-2-4-7-12/h2-10H,1H3 |
| InChIKey | QVWLBMJALVOEKM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |