C14H6F6O — CID 71371842
1,1,2,2,3,3-hexafluorobenzo[f]azulen-5-one (PubChem CID 71371842) has the molecular formula C14H6F6O and a molecular weight of 304.19 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobenzo[f]azulen-5-one.
| Compound Name | 1,1,2,2,3,3-hexafluorobenzo[f]azulen-5-one |
|---|---|
| PubChem CID | 71371842 |
| Molecular Formula | C14H6F6O |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobenzo[f]azulen-5-one |
| SMILES | O=c1cc2c(cc3ccccc13)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C14H6F6O/c15-12(16)9-5-7-3-1-2-4-8(7)11(21)6-10(9)13(17,18)14(12,19)20/h1-6H |
| InChIKey | YSPKBTYUWINDNL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|