About 2-butyl-4-phenylfuran
2-butyl-4-phenylfuran (PubChem CID 71372399) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-butyl-4-phenylfuran.
Molecular Properties
| Compound Name | 2-butyl-4-phenylfuran |
| PubChem CID | 71372399 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-butyl-4-phenylfuran |
| SMILES | CCCCc1cc(-c2ccccc2)co1 |
| InChI | InChI=1S/C14H16O/c1-2-3-9-14-10-13(11-15-14)12-7-5-4-6-8-12/h4-8,10-11H,2-3,9H2,1H3 |
| InChIKey | GYIXTWHHRVNNPH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-4-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-phenylfuran?
The IUPAC name of 2-butyl-4-phenylfuran (CID 71372399) is 2-butyl-4-phenylfuran.
What is the SMILES notation for 2-butyl-4-phenylfuran?
The canonical SMILES for 2-butyl-4-phenylfuran is CCCCc1cc(-c2ccccc2)co1.
What is the InChIKey of 2-butyl-4-phenylfuran?
The InChIKey is GYIXTWHHRVNNPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O/c1-2-3-9-14-10-13(11-15-14)12-7-5-4-6-8-12/h4-8,10-11H,2-3,9H2,1H3.
What are the key properties of 2-butyl-4-phenylfuran?
2-butyl-4-phenylfuran has a molecular weight of 200.28 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-phenylfuran is sourced from PubChem (CID 71372399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).