C8H13NO3 — CID 71372992
cis-(4R,5S)-2,2,4-trimethyl-5-nitrocyclopentan-1-one (PubChem CID 71372992) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is cis-(4R,5S)-2,2,4-trimethyl-5-nitrocyclopentan-1-one.
| Compound Name | cis-(4R,5S)-2,2,4-trimethyl-5-nitrocyclopentan-1-one |
|---|---|
| PubChem CID | 71372992 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | cis-(4R,5S)-2,2,4-trimethyl-5-nitrocyclopentan-1-one |
| SMILES | C[C@@H]1CC(C)(C)C(=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO3/c1-5-4-8(2,3)7(10)6(5)9(11)12/h5-6H,4H2,1-3H3/t5-,6+/m1/s1 |
| InChIKey | ZGWQHWVJWVNLPX-RITPCOANSA-N |
| XLogP | 1.27 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|