About 1-benzyl-5-ethenylindole
1-benzyl-5-ethenylindole (PubChem CID 71373149) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-benzyl-5-ethenylindole.
Molecular Properties
| Compound Name | 1-benzyl-5-ethenylindole |
| PubChem CID | 71373149 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-benzyl-5-ethenylindole |
| SMILES | C=Cc1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H15N/c1-2-14-8-9-17-16(12-14)10-11-18(17)13-15-6-4-3-5-7-15/h2-12H,1,13H2 |
| InChIKey | UPFCAOVZOHEFLF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-5-ethenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-ethenylindole?
The IUPAC name of 1-benzyl-5-ethenylindole (CID 71373149) is 1-benzyl-5-ethenylindole.
What is the SMILES notation for 1-benzyl-5-ethenylindole?
The canonical SMILES for 1-benzyl-5-ethenylindole is C=Cc1ccc2c(ccn2Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-5-ethenylindole?
The InChIKey is UPFCAOVZOHEFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-2-14-8-9-17-16(12-14)10-11-18(17)13-15-6-4-3-5-7-15/h2-12H,1,13H2.
What are the key properties of 1-benzyl-5-ethenylindole?
1-benzyl-5-ethenylindole has a molecular weight of 233.31 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-ethenylindole is sourced from PubChem (CID 71373149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).