C16H22O4 — CID 71373264
6,8-dimethoxy-3-pentyl-3,4-dihydroisochromen-1-one (PubChem CID 71373264) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 6,8-dimethoxy-3-pentyl-3,4-dihydroisochromen-1-one.
| Compound Name | 6,8-dimethoxy-3-pentyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 71373264 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6,8-dimethoxy-3-pentyl-3,4-dihydroisochromen-1-one |
| SMILES | CCCCCC1Cc2cc(OC)cc(OC)c2C(=O)O1 |
| InChI | InChI=1S/C16H22O4/c1-4-5-6-7-12-8-11-9-13(18-2)10-14(19-3)15(11)16(17)20-12/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | JPXNWBDNQCYZQN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|