About dichloro-bis[(3,4-dimethylphenyl)methyl]stannane
dichloro-bis[(3,4-dimethylphenyl)methyl]stannane (PubChem CID 71373322) has the molecular formula C18H22Cl2Sn
and a molecular weight of 427.99 g/mol. Its IUPAC name is dichloro-bis[(3,4-dimethylphenyl)methyl]stannane.
Molecular Properties
| Compound Name | dichloro-bis[(3,4-dimethylphenyl)methyl]stannane |
| PubChem CID | 71373322 |
| Molecular Formula | C18H22Cl2Sn |
| Molecular Weight | 427.99 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | dichloro-bis[(3,4-dimethylphenyl)methyl]stannane |
| SMILES | Cc1ccc(C[Sn](Cl)(Cl)Cc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/2C9H11.2ClH.Sn/c2*1-7-4-5-8(2)9(3)6-7;;;/h2*4-6H,1H2,2-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | RHVYOZNTQNNFFJ-UHFFFAOYSA-L |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichloro-bis[(3,4-dimethylphenyl)methyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-bis[(3,4-dimethylphenyl)methyl]stannane?
The IUPAC name of dichloro-bis[(3,4-dimethylphenyl)methyl]stannane (CID 71373322) is dichloro-bis[(3,4-dimethylphenyl)methyl]stannane.
What is the SMILES notation for dichloro-bis[(3,4-dimethylphenyl)methyl]stannane?
The canonical SMILES for dichloro-bis[(3,4-dimethylphenyl)methyl]stannane is Cc1ccc(C[Sn](Cl)(Cl)Cc2ccc(C)c(C)c2)cc1C.
What is the InChIKey of dichloro-bis[(3,4-dimethylphenyl)methyl]stannane?
The InChIKey is RHVYOZNTQNNFFJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H11.2ClH.Sn/c2*1-7-4-5-8(2)9(3)6-7;;;/h2*4-6H,1H2,2-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloro-bis[(3,4-dimethylphenyl)methyl]stannane?
dichloro-bis[(3,4-dimethylphenyl)methyl]stannane has a molecular weight of 427.99 g/mol, XLogP of 5.70, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-bis[(3,4-dimethylphenyl)methyl]stannane is sourced from PubChem (CID 71373322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).