About 2,2-dimethylsiletane
2,2-dimethylsiletane (PubChem CID 71373499) has the molecular formula C5H12Si
and a molecular weight of 100.24 g/mol. Its IUPAC name is 2,2-dimethylsiletane.
Molecular Properties
| Compound Name | 2,2-dimethylsiletane |
| PubChem CID | 71373499 |
| Molecular Formula | C5H12Si |
| Molecular Weight | 100.24 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | 2,2-dimethylsiletane |
| SMILES | CC1(C)CC[SiH2]1 |
| InChI | InChI=1S/C5H12Si/c1-5(2)3-4-6-5/h3-4,6H2,1-2H3 |
| InChIKey | HRRZTBKBJIARQR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylsiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylsiletane?
The IUPAC name of 2,2-dimethylsiletane (CID 71373499) is 2,2-dimethylsiletane.
What is the SMILES notation for 2,2-dimethylsiletane?
The canonical SMILES for 2,2-dimethylsiletane is CC1(C)CC[SiH2]1.
What is the InChIKey of 2,2-dimethylsiletane?
The InChIKey is HRRZTBKBJIARQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12Si/c1-5(2)3-4-6-5/h3-4,6H2,1-2H3.
What are the key properties of 2,2-dimethylsiletane?
2,2-dimethylsiletane has a molecular weight of 100.24 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylsiletane is sourced from PubChem (CID 71373499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).