C12H20N6 — CID 71373653
6,7-di(propan-2-yl)-7,8-dihydropteridine-2,4-diamine (PubChem CID 71373653) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6,7-di(propan-2-yl)-7,8-dihydropteridine-2,4-diamine.
| Compound Name | 6,7-di(propan-2-yl)-7,8-dihydropteridine-2,4-diamine |
|---|---|
| PubChem CID | 71373653 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6,7-di(propan-2-yl)-7,8-dihydropteridine-2,4-diamine |
| SMILES | CC(C)C1=Nc2c(N)nc(N)nc2NC1C(C)C |
| InChI | InChI=1S/C12H20N6/c1-5(2)7-8(6(3)4)16-11-9(15-7)10(13)17-12(14)18-11/h5-6,8H,1-4H3,(H5,13,14,16,17,18) |
| InChIKey | GKLLXFGTZBQXPK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |