C16H24O2 — CID 71373655
hexadeca-2,4,6,8,10-pentaene-1,13-diol (PubChem CID 71373655) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is hexadeca-2,4,6,8,10-pentaene-1,13-diol.
| Compound Name | hexadeca-2,4,6,8,10-pentaene-1,13-diol |
|---|---|
| PubChem CID | 71373655 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | hexadeca-2,4,6,8,10-pentaene-1,13-diol |
| SMILES | CCCC(O)CC=CC=CC=CC=CC=CCO |
| InChI | InChI=1S/C16H24O2/c1-2-13-16(18)14-11-9-7-5-3-4-6-8-10-12-15-17/h3-12,16-18H,2,13-15H2,1H3 |
| InChIKey | IKXVFBGDFMVZDZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|