C26H43N7O6 — CID 71373723
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 71373723) has the molecular formula C26H43N7O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 71373723 |
| Molecular Formula | C26H43N7O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)C(C)C)C(=O)O |
| InChI | InChI=1S/C26H43N7O6/c1-14(2)12-20(25(38)39)33-23(36)19(13-16-7-9-17(34)10-8-16)32-22(35)18(6-5-11-30-26(28)29)31-24(37)21(27)15(3)4/h7-10,14-15,18-21,34H,5-6,11-13,27H2,1-4H3,(H,31,37)(H,32,35)(H,33,36)(H,38,39)(H4,28,29,30)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | BYUOUPCTZUCTKM-TUFLPTIASA-N |
| XLogP | -0.44 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|