C11H14N2O — CID 71373792
2-methyl-1-(4,5,6,7-tetrahydroindazol-1-yl)prop-2-en-1-one (PubChem CID 71373792) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-methyl-1-(4,5,6,7-tetrahydroindazol-1-yl)prop-2-en-1-one.
| Compound Name | 2-methyl-1-(4,5,6,7-tetrahydroindazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71373792 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-methyl-1-(4,5,6,7-tetrahydroindazol-1-yl)prop-2-en-1-one |
| SMILES | C=C(C)C(=O)n1ncc2c1CCCC2 |
| InChI | InChI=1S/C11H14N2O/c1-8(2)11(14)13-10-6-4-3-5-9(10)7-12-13/h7H,1,3-6H2,2H3 |
| InChIKey | FSOAVFYHNNPCGT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|