About 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride
1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride (PubChem CID 71373897) has the molecular formula C10H19Cl2N
and a molecular weight of 224.17 g/mol. Its IUPAC name is 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride.
Molecular Properties
| Compound Name | 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride |
| PubChem CID | 71373897 |
| Molecular Formula | C10H19Cl2N |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride |
| SMILES | C[N+]1(C)C2CCCC1(Cl)CCC2.[Cl-] |
| InChI | InChI=1S/C10H19ClN.ClH/c1-12(2)9-5-3-7-10(12,11)8-4-6-9;/h9H,3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MJNOKAQAZUPFOD-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride?
The IUPAC name of 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride (CID 71373897) is 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride.
What is the SMILES notation for 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride?
The canonical SMILES for 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride is C[N+]1(C)C2CCCC1(Cl)CCC2.[Cl-].
What is the InChIKey of 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride?
The InChIKey is MJNOKAQAZUPFOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H19ClN.ClH/c1-12(2)9-5-3-7-10(12,11)8-4-6-9;/h9H,3-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride?
1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride has a molecular weight of 224.17 g/mol, XLogP of -0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane chloride is sourced from PubChem (CID 71373897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).