C13H16O4 — CID 71373915
2-hydroxy-5,11-dimethoxyspiro[5.5]undeca-1,4,9-trien-3-one (PubChem CID 71373915) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-hydroxy-5,11-dimethoxyspiro[5.5]undeca-1,4,9-trien-3-one.
| Compound Name | 2-hydroxy-5,11-dimethoxyspiro[5.5]undeca-1,4,9-trien-3-one |
|---|---|
| PubChem CID | 71373915 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-hydroxy-5,11-dimethoxyspiro[5.5]undeca-1,4,9-trien-3-one |
| SMILES | COC1=CC(=O)C(O)=CC12CCC=CC2OC |
| InChI | InChI=1S/C13H16O4/c1-16-11-5-3-4-6-13(11)8-10(15)9(14)7-12(13)17-2/h3,5,7-8,11,15H,4,6H2,1-2H3 |
| InChIKey | BBVVECSMKRHYCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|