C18H18ClN5S — CID 71373927
2-(3,5-diphenyl-1H-tetrazol-1-ium-2-yl)-4,5-dimethyl-1,3-thiazole chloride (PubChem CID 71373927) has the molecular formula C18H18ClN5S and a molecular weight of 371.90 g/mol. Its IUPAC name is 2-(3,5-diphenyl-1H-tetrazol-1-ium-2-yl)-4,5-dimethyl-1,3-thiazole chloride.
| Compound Name | 2-(3,5-diphenyl-1H-tetrazol-1-ium-2-yl)-4,5-dimethyl-1,3-thiazole chloride |
|---|---|
| PubChem CID | 71373927 |
| Molecular Formula | C18H18ClN5S |
| Molecular Weight | 371.90 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(3,5-diphenyl-1H-tetrazol-1-ium-2-yl)-4,5-dimethyl-1,3-thiazole chloride |
| SMILES | Cc1nc(N2[NH2+]C(c3ccccc3)=NN2c2ccccc2)sc1C.[Cl-] |
| InChI | InChI=1S/C18H17N5S.ClH/c1-13-14(2)24-18(19-13)23-21-17(15-9-5-3-6-10-15)20-22(23)16-11-7-4-8-12-16;/h3-12H,1-2H3,(H,20,21);1H |
| InChIKey | KYENMFWIKMBWJG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 48.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.90 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|