C4H8N2O5 — CID 71373932
1,3-diazinane-2,4,6-trione;dihydrate (PubChem CID 71373932) has the molecular formula C4H8N2O5 and a molecular weight of 164.12 g/mol. Its IUPAC name is 1,3-diazinane-2,4,6-trione;dihydrate.
| Compound Name | 1,3-diazinane-2,4,6-trione;dihydrate |
|---|---|
| PubChem CID | 71373932 |
| Molecular Formula | C4H8N2O5 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 1,3-diazinane-2,4,6-trione;dihydrate |
| SMILES | O.O.O=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C4H4N2O3.2H2O/c7-2-1-3(8)6-4(9)5-2;;/h1H2,(H2,5,6,7,8,9);2*1H2 |
| InChIKey | YVLZEVXQPWSUKV-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|