C8H6F6 — CID 71374055
1,3,3,4,6,6-hexafluoro-2,5-dimethylcyclohexa-1,4-diene (PubChem CID 71374055) has the molecular formula C8H6F6 and a molecular weight of 216.12 g/mol. Its IUPAC name is 1,3,3,4,6,6-hexafluoro-2,5-dimethylcyclohexa-1,4-diene.
| Compound Name | 1,3,3,4,6,6-hexafluoro-2,5-dimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 71374055 |
| Molecular Formula | C8H6F6 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1,3,3,4,6,6-hexafluoro-2,5-dimethylcyclohexa-1,4-diene |
| SMILES | CC1=C(F)C(F)(F)C(C)=C(F)C1(F)F |
| InChI | InChI=1S/C8H6F6/c1-3-5(9)8(13,14)4(2)6(10)7(3,11)12/h1-2H3 |
| InChIKey | VZEVJKBXYWEBAY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |