About 5-aminohept-6-ynoic acid
5-aminohept-6-ynoic acid (PubChem CID 71374122) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 5-aminohept-6-ynoic acid.
Molecular Properties
| Compound Name | 5-aminohept-6-ynoic acid |
| PubChem CID | 71374122 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 5-aminohept-6-ynoic acid |
| SMILES | C#CC(N)CCCC(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-2-6(8)4-3-5-7(9)10/h1,6H,3-5,8H2,(H,9,10) |
| InChIKey | CLSRVPDEBYXVNI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-aminohept-6-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminohept-6-ynoic acid?
The IUPAC name of 5-aminohept-6-ynoic acid (CID 71374122) is 5-aminohept-6-ynoic acid.
What is the SMILES notation for 5-aminohept-6-ynoic acid?
The canonical SMILES for 5-aminohept-6-ynoic acid is C#CC(N)CCCC(=O)O.
What is the InChIKey of 5-aminohept-6-ynoic acid?
The InChIKey is CLSRVPDEBYXVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-6(8)4-3-5-7(9)10/h1,6H,3-5,8H2,(H,9,10).
What are the key properties of 5-aminohept-6-ynoic acid?
5-aminohept-6-ynoic acid has a molecular weight of 141.17 g/mol, XLogP of 0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminohept-6-ynoic acid is sourced from PubChem (CID 71374122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).