C9H4Cl2F3N3 — CID 71374173
3-(3,4-dichlorophenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 71374173) has the molecular formula C9H4Cl2F3N3 and a molecular weight of 282.05 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(3,4-dichlorophenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 71374173 |
| Molecular Formula | C9H4Cl2F3N3 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1nc(-c2ccc(Cl)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C9H4Cl2F3N3/c10-5-2-1-4(3-6(5)11)7-15-8(17-16-7)9(12,13)14/h1-3H,(H,15,16,17) |
| InChIKey | RJOIGCWOBOATCJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |