C18H12N4O — CID 71374228
2-(5,6-diphenyl-1,2,4-triazin-3-yl)-1,3-oxazole (PubChem CID 71374228) has the molecular formula C18H12N4O and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-(5,6-diphenyl-1,2,4-triazin-3-yl)-1,3-oxazole.
| Compound Name | 2-(5,6-diphenyl-1,2,4-triazin-3-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 71374228 |
| Molecular Formula | C18H12N4O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(5,6-diphenyl-1,2,4-triazin-3-yl)-1,3-oxazole |
| SMILES | c1ccc(-c2nnc(-c3ncco3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H12N4O/c1-3-7-13(8-4-1)15-16(14-9-5-2-6-10-14)21-22-17(20-15)18-19-11-12-23-18/h1-12H |
| InChIKey | LVQZUQPYMAPPGD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |