About 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide
2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide (PubChem CID 71374262) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide |
| PubChem CID | 71374262 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1C=CCO1 |
| InChI | InChI=1S/C10H17NO2/c1-3-11(4-2)10(12)8-9-6-5-7-13-9/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | FAKDGNUBRGKAPL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide?
The IUPAC name of 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide (CID 71374262) is 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide.
What is the SMILES notation for 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide?
The canonical SMILES for 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide is CCN(CC)C(=O)CC1C=CCO1.
What is the InChIKey of 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide?
The InChIKey is FAKDGNUBRGKAPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-11(4-2)10(12)8-9-6-5-7-13-9/h5-6,9H,3-4,7-8H2,1-2H3.
What are the key properties of 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide?
2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide has a molecular weight of 183.25 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydrofuran-2-yl)-N,N-diethylacetamide is sourced from PubChem (CID 71374262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).