About 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride
7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 71374370) has the molecular formula C15H13Cl2N
and a molecular weight of 278.18 g/mol. Its IUPAC name is 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 71374370 |
| Molecular Formula | C15H13Cl2N |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | Cl.Clc1ccc2c(c1)C(c1ccccc1)=NCC2 |
| InChI | InChI=1S/C15H12ClN.ClH/c16-13-7-6-11-8-9-17-15(14(11)10-13)12-4-2-1-3-5-12;/h1-7,10H,8-9H2;1H |
| InChIKey | AYMRNYITRVHDGM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride (CID 71374370) is 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride is Cl.Clc1ccc2c(c1)C(c1ccccc1)=NCC2.
What is the InChIKey of 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is AYMRNYITRVHDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN.ClH/c16-13-7-6-11-8-9-17-15(14(11)10-13)12-4-2-1-3-5-12;/h1-7,10H,8-9H2;1H.
What are the key properties of 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride?
7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 278.18 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-phenyl-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 71374370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).