C9H12O — CID 71374396
1b,2,5,5a,6,6a-hexahydro-1aH-indeno[1,2-b]oxirene (PubChem CID 71374396) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 1b,2,5,5a,6,6a-hexahydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | 1b,2,5,5a,6,6a-hexahydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 71374396 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1b,2,5,5a,6,6a-hexahydro-1aH-indeno[1,2-b]oxirene |
| SMILES | C1=CCC2C(C1)CC1OC12 |
| InChI | InChI=1S/C9H12O/c1-2-4-7-6(3-1)5-8-9(7)10-8/h1-2,6-9H,3-5H2 |
| InChIKey | SPKNXQOYYXRWJF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|