About 3,5-dimethylhexanenitrile
3,5-dimethylhexanenitrile (PubChem CID 71374425) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is 3,5-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 3,5-dimethylhexanenitrile |
| PubChem CID | 71374425 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 3,5-dimethylhexanenitrile |
| SMILES | CC(C)CC(C)CC#N |
| InChI | InChI=1S/C8H15N/c1-7(2)6-8(3)4-5-9/h7-8H,4,6H2,1-3H3 |
| InChIKey | PLOIXTARDKUIKQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylhexanenitrile?
The IUPAC name of 3,5-dimethylhexanenitrile (CID 71374425) is 3,5-dimethylhexanenitrile.
What is the SMILES notation for 3,5-dimethylhexanenitrile?
The canonical SMILES for 3,5-dimethylhexanenitrile is CC(C)CC(C)CC#N.
What is the InChIKey of 3,5-dimethylhexanenitrile?
The InChIKey is PLOIXTARDKUIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-7(2)6-8(3)4-5-9/h7-8H,4,6H2,1-3H3.
What are the key properties of 3,5-dimethylhexanenitrile?
3,5-dimethylhexanenitrile has a molecular weight of 125.22 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylhexanenitrile is sourced from PubChem (CID 71374425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).