About cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one
cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one (PubChem CID 71374448) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one.
Molecular Properties
| Compound Name | cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one |
| PubChem CID | 71374448 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one |
| SMILES | C[C@@H]1CC[C@H](C(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C11H18O2/c1-7-5-6-8(9(7)12)10(13)11(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | ANOOWFJNRBSPBT-SFYZADRCSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one?
The IUPAC name of cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one (CID 71374448) is cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one.
What is the SMILES notation for cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one?
The canonical SMILES for cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one is C[C@@H]1CC[C@H](C(=O)C(C)(C)C)C1=O.
What is the InChIKey of cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one?
The InChIKey is ANOOWFJNRBSPBT-SFYZADRCSA-N. The full InChI is InChI=1S/C11H18O2/c1-7-5-6-8(9(7)12)10(13)11(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1.
What are the key properties of cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one?
cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one has a molecular weight of 182.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,5R)-2-(2,2-dimethylpropanoyl)-5-methylcyclopentan-1-one is sourced from PubChem (CID 71374448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).