C17H10ClFN4O5 — CID 7137455
3-(3-chloro-4-fluorophenyl)-N-(4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 7137455) has the molecular formula C17H10ClFN4O5 and a molecular weight of 404.74 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-(4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-(4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 7137455 |
| Molecular Formula | C17H10ClFN4O5 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-(4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1c[nH]c(=O)n(-c2ccc(F)c(Cl)c2)c1=O |
| InChI | InChI=1S/C17H10ClFN4O5/c18-13-7-11(5-6-14(13)19)22-16(25)12(8-20-17(22)26)15(24)21-9-1-3-10(4-2-9)23(27)28/h1-8H,(H,20,26)(H,21,24) |
| InChIKey | RMAAUCUPVZISKM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|