About S-(3-bromophenyl) ethanethioate
S-(3-bromophenyl) ethanethioate (PubChem CID 71374837) has the molecular formula C8H7BrOS
and a molecular weight of 231.11 g/mol. Its IUPAC name is S-(3-bromophenyl) ethanethioate.
Molecular Properties
| Compound Name | S-(3-bromophenyl) ethanethioate |
| PubChem CID | 71374837 |
| Molecular Formula | C8H7BrOS |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | S-(3-bromophenyl) ethanethioate |
| SMILES | CC(=O)Sc1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrOS/c1-6(10)11-8-4-2-3-7(9)5-8/h2-5H,1H3 |
| InChIKey | FEFUIDALTGGVND-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-bromophenyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-bromophenyl) ethanethioate?
The IUPAC name of S-(3-bromophenyl) ethanethioate (CID 71374837) is S-(3-bromophenyl) ethanethioate.
What is the SMILES notation for S-(3-bromophenyl) ethanethioate?
The canonical SMILES for S-(3-bromophenyl) ethanethioate is CC(=O)Sc1cccc(Br)c1.
What is the InChIKey of S-(3-bromophenyl) ethanethioate?
The InChIKey is FEFUIDALTGGVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrOS/c1-6(10)11-8-4-2-3-7(9)5-8/h2-5H,1H3.
What are the key properties of S-(3-bromophenyl) ethanethioate?
S-(3-bromophenyl) ethanethioate has a molecular weight of 231.11 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-bromophenyl) ethanethioate is sourced from PubChem (CID 71374837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).