C8H16O2Si — CID 71374857
(3S,4R)-4-ethyl-3-trimethylsilyloxetan-2-one (PubChem CID 71374857) has the molecular formula C8H16O2Si and a molecular weight of 172.30 g/mol. Its IUPAC name is (3S,4R)-4-ethyl-3-trimethylsilyloxetan-2-one.
| Compound Name | (3S,4R)-4-ethyl-3-trimethylsilyloxetan-2-one |
|---|---|
| PubChem CID | 71374857 |
| Molecular Formula | C8H16O2Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (3S,4R)-4-ethyl-3-trimethylsilyloxetan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C8H16O2Si/c1-5-6-7(8(9)10-6)11(2,3)4/h6-7H,5H2,1-4H3/t6-,7+/m1/s1 |
| InChIKey | HSLKCCNEEPYDMB-RQJHMYQMSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|