About [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea
[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea (PubChem CID 71374888) has the molecular formula C7H6N4OS2
and a molecular weight of 226.29 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea.
Molecular Properties
| Compound Name | [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea |
| PubChem CID | 71374888 |
| Molecular Formula | C7H6N4OS2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea |
| SMILES | NC(=S)Nc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C7H6N4OS2/c8-6(13)9-7-11-10-5(14-7)4-2-1-3-12-4/h1-3H,(H3,8,9,11,13) |
| InChIKey | KKDNBBBMHCDAGO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea?
The IUPAC name of [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea (CID 71374888) is [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea.
What is the SMILES notation for [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea?
The canonical SMILES for [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea is NC(=S)Nc1nnc(-c2ccco2)s1.
What is the InChIKey of [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea?
The InChIKey is KKDNBBBMHCDAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4OS2/c8-6(13)9-7-11-10-5(14-7)4-2-1-3-12-4/h1-3H,(H3,8,9,11,13).
What are the key properties of [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea?
[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea has a molecular weight of 226.29 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]thiourea is sourced from PubChem (CID 71374888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).