About 4-methyl-3,6-bis(trifluoromethyl)pyridazine
4-methyl-3,6-bis(trifluoromethyl)pyridazine (PubChem CID 71374916) has the molecular formula C7H4F6N2
and a molecular weight of 230.11 g/mol. Its IUPAC name is 4-methyl-3,6-bis(trifluoromethyl)pyridazine.
Molecular Properties
| Compound Name | 4-methyl-3,6-bis(trifluoromethyl)pyridazine |
| PubChem CID | 71374916 |
| Molecular Formula | C7H4F6N2 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 4-methyl-3,6-bis(trifluoromethyl)pyridazine |
| SMILES | Cc1cc(C(F)(F)F)nnc1C(F)(F)F |
| InChI | InChI=1S/C7H4F6N2/c1-3-2-4(6(8,9)10)14-15-5(3)7(11,12)13/h2H,1H3 |
| InChIKey | CCQZAYLJQVXHFO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3,6-bis(trifluoromethyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,6-bis(trifluoromethyl)pyridazine?
The IUPAC name of 4-methyl-3,6-bis(trifluoromethyl)pyridazine (CID 71374916) is 4-methyl-3,6-bis(trifluoromethyl)pyridazine.
What is the SMILES notation for 4-methyl-3,6-bis(trifluoromethyl)pyridazine?
The canonical SMILES for 4-methyl-3,6-bis(trifluoromethyl)pyridazine is Cc1cc(C(F)(F)F)nnc1C(F)(F)F.
What is the InChIKey of 4-methyl-3,6-bis(trifluoromethyl)pyridazine?
The InChIKey is CCQZAYLJQVXHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F6N2/c1-3-2-4(6(8,9)10)14-15-5(3)7(11,12)13/h2H,1H3.
What are the key properties of 4-methyl-3,6-bis(trifluoromethyl)pyridazine?
4-methyl-3,6-bis(trifluoromethyl)pyridazine has a molecular weight of 230.11 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,6-bis(trifluoromethyl)pyridazine is sourced from PubChem (CID 71374916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).