About 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide
1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide (PubChem CID 71375198) has the molecular formula C18H28N6O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide |
| PubChem CID | 71375198 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide |
| SMILES | CN(C)C(=NC(=O)c1cccc(C(=O)N=C(N(C)C)N(C)C)c1)N(C)C |
| InChI | InChI=1S/C18H28N6O2/c1-21(2)17(22(3)4)19-15(25)13-10-9-11-14(12-13)16(26)20-18(23(5)6)24(7)8/h9-12H,1-8H3 |
| InChIKey | VTFBZCNQUYNKRI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide (CID 71375198) is 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide is CN(C)C(=NC(=O)c1cccc(C(=O)N=C(N(C)C)N(C)C)c1)N(C)C.
What is the InChIKey of 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide?
The InChIKey is VTFBZCNQUYNKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N6O2/c1-21(2)17(22(3)4)19-15(25)13-10-9-11-14(12-13)16(26)20-18(23(5)6)24(7)8/h9-12H,1-8H3.
What are the key properties of 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide?
1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide has a molecular weight of 360.46 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis[bis(dimethylamino)methylidene]benzene-1,3-dicarboxamide is sourced from PubChem (CID 71375198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).