About N-(2-methylpropyl)hexa-2,4-dienamide
N-(2-methylpropyl)hexa-2,4-dienamide (PubChem CID 71375318) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-(2-methylpropyl)hexa-2,4-dienamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)hexa-2,4-dienamide |
| PubChem CID | 71375318 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-(2-methylpropyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C10H17NO/c1-4-5-6-7-10(12)11-8-9(2)3/h4-7,9H,8H2,1-3H3,(H,11,12) |
| InChIKey | DHXYPSWRPDLKGG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)hexa-2,4-dienamide?
The IUPAC name of N-(2-methylpropyl)hexa-2,4-dienamide (CID 71375318) is N-(2-methylpropyl)hexa-2,4-dienamide.
What is the SMILES notation for N-(2-methylpropyl)hexa-2,4-dienamide?
The canonical SMILES for N-(2-methylpropyl)hexa-2,4-dienamide is CC=CC=CC(=O)NCC(C)C.
What is the InChIKey of N-(2-methylpropyl)hexa-2,4-dienamide?
The InChIKey is DHXYPSWRPDLKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-5-6-7-10(12)11-8-9(2)3/h4-7,9H,8H2,1-3H3,(H,11,12).
What are the key properties of N-(2-methylpropyl)hexa-2,4-dienamide?
N-(2-methylpropyl)hexa-2,4-dienamide has a molecular weight of 167.25 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)hexa-2,4-dienamide is sourced from PubChem (CID 71375318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).