C20H16N4 — CID 71375396
1-methyl-2,5-diphenylpyrido[3,2-e][1,2,4]triazepine (PubChem CID 71375396) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-methyl-2,5-diphenylpyrido[3,2-e][1,2,4]triazepine.
| Compound Name | 1-methyl-2,5-diphenylpyrido[3,2-e][1,2,4]triazepine |
|---|---|
| PubChem CID | 71375396 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-methyl-2,5-diphenylpyrido[3,2-e][1,2,4]triazepine |
| SMILES | CN1C(c2ccccc2)=NN=C(c2ccccc2)c2ncccc21 |
| InChI | InChI=1S/C20H16N4/c1-24-17-13-8-14-21-19(17)18(15-9-4-2-5-10-15)22-23-20(24)16-11-6-3-7-12-16/h2-14H,1H3 |
| InChIKey | BBXUERVLUTTZCF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |