C17H28O3 — CID 71375447
2-[2,2-dimethyl-5-(2-methylideneoct-3-enyl)-1,3-dioxan-5-yl]acetaldehyde (PubChem CID 71375447) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[2,2-dimethyl-5-(2-methylideneoct-3-enyl)-1,3-dioxan-5-yl]acetaldehyde.
| Compound Name | 2-[2,2-dimethyl-5-(2-methylideneoct-3-enyl)-1,3-dioxan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 71375447 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[2,2-dimethyl-5-(2-methylideneoct-3-enyl)-1,3-dioxan-5-yl]acetaldehyde |
| SMILES | C=C(C=CCCCC)CC1(CC=O)COC(C)(C)OC1 |
| InChI | InChI=1S/C17H28O3/c1-5-6-7-8-9-15(2)12-17(10-11-18)13-19-16(3,4)20-14-17/h8-9,11H,2,5-7,10,12-14H2,1,3-4H3 |
| InChIKey | FYDMMVPRSBCDMP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|