About 2-azabicyclo[2.2.0]hexa-2,5-diene
2-azabicyclo[2.2.0]hexa-2,5-diene (PubChem CID 71375521) has the molecular formula C5H5N
and a molecular weight of 79.10 g/mol. Its IUPAC name is 2-azabicyclo[2.2.0]hexa-2,5-diene.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.0]hexa-2,5-diene |
| PubChem CID | 71375521 |
| Molecular Formula | C5H5N |
| Molecular Weight | 79.10 g/mol |
| Exact Mass | 79.04 |
| IUPAC Name | 2-azabicyclo[2.2.0]hexa-2,5-diene |
| SMILES | C1=CC2N=CC12 |
| InChI | InChI=1S/C5H5N/c1-2-5-4(1)3-6-5/h1-5H |
| InChIKey | UKZSOLAUQNXPLD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azabicyclo[2.2.0]hexa-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.0]hexa-2,5-diene?
The IUPAC name of 2-azabicyclo[2.2.0]hexa-2,5-diene (CID 71375521) is 2-azabicyclo[2.2.0]hexa-2,5-diene.
What is the SMILES notation for 2-azabicyclo[2.2.0]hexa-2,5-diene?
The canonical SMILES for 2-azabicyclo[2.2.0]hexa-2,5-diene is C1=CC2N=CC12.
What is the InChIKey of 2-azabicyclo[2.2.0]hexa-2,5-diene?
The InChIKey is UKZSOLAUQNXPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N/c1-2-5-4(1)3-6-5/h1-5H.
What are the key properties of 2-azabicyclo[2.2.0]hexa-2,5-diene?
2-azabicyclo[2.2.0]hexa-2,5-diene has a molecular weight of 79.10 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.0]hexa-2,5-diene is sourced from PubChem (CID 71375521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).