About methanesulfonic acid;4-phenylbutan-1-ol
methanesulfonic acid;4-phenylbutan-1-ol (PubChem CID 71375764) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is methanesulfonic acid;4-phenylbutan-1-ol.
Molecular Properties
| Compound Name | methanesulfonic acid;4-phenylbutan-1-ol |
| PubChem CID | 71375764 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methanesulfonic acid;4-phenylbutan-1-ol |
| SMILES | CS(=O)(=O)O.OCCCCc1ccccc1 |
| InChI | InChI=1S/C10H14O.CH4O3S/c11-9-5-4-8-10-6-2-1-3-7-10;1-5(2,3)4/h1-3,6-7,11H,4-5,8-9H2;1H3,(H,2,3,4) |
| InChIKey | CIZOMPBJUCKUPS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;4-phenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;4-phenylbutan-1-ol?
The IUPAC name of methanesulfonic acid;4-phenylbutan-1-ol (CID 71375764) is methanesulfonic acid;4-phenylbutan-1-ol.
What is the SMILES notation for methanesulfonic acid;4-phenylbutan-1-ol?
The canonical SMILES for methanesulfonic acid;4-phenylbutan-1-ol is CS(=O)(=O)O.OCCCCc1ccccc1.
What is the InChIKey of methanesulfonic acid;4-phenylbutan-1-ol?
The InChIKey is CIZOMPBJUCKUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.CH4O3S/c11-9-5-4-8-10-6-2-1-3-7-10;1-5(2,3)4/h1-3,6-7,11H,4-5,8-9H2;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;4-phenylbutan-1-ol?
methanesulfonic acid;4-phenylbutan-1-ol has a molecular weight of 246.33 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;4-phenylbutan-1-ol is sourced from PubChem (CID 71375764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).