C6H6N2O2 — CID 71376185
1,5-dihydro-1,5-diazocine-2,6-dione (PubChem CID 71376185) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 1,5-dihydro-1,5-diazocine-2,6-dione.
| Compound Name | 1,5-dihydro-1,5-diazocine-2,6-dione |
|---|---|
| PubChem CID | 71376185 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 1,5-dihydro-1,5-diazocine-2,6-dione |
| SMILES | O=C1C=CNC(=O)C=CN1 |
| InChI | InChI=1S/C6H6N2O2/c9-5-1-3-7-6(10)2-4-8-5/h1-4H,(H,7,10)(H,8,9) |
| InChIKey | PNOZCJLGKWLDSL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |