About CID 71376373
CID 71376373 (PubChem CID 71376373) has the molecular formula C8H16MgO
and a molecular weight of 152.52 g/mol.
Molecular Properties
| Compound Name | CID 71376373 |
| PubChem CID | 71376373 |
| Molecular Formula | C8H16MgO |
| Molecular Weight | 152.52 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | — |
| SMILES | CCC1(CC)CCCO1.[Mg] |
| InChI | InChI=1S/C8H16O.Mg/c1-3-8(4-2)6-5-7-9-8;/h3-7H2,1-2H3; |
| InChIKey | RAIJOOLXQOSKGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 71376373 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71376373?
The IUPAC name of CID 71376373 (CID 71376373) is not available.
What is the SMILES notation for CID 71376373?
The canonical SMILES for CID 71376373 is CCC1(CC)CCCO1.[Mg].
What is the InChIKey of CID 71376373?
The InChIKey is RAIJOOLXQOSKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.Mg/c1-3-8(4-2)6-5-7-9-8;/h3-7H2,1-2H3;.
What are the key properties of CID 71376373?
CID 71376373 has a molecular weight of 152.52 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71376373 is sourced from PubChem (CID 71376373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).